C15H22N4O — CID 167928357
7-cyclopropyl-N-(3-propan-2-yloxypropyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 167928357) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 7-cyclopropyl-N-(3-propan-2-yloxypropyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-cyclopropyl-N-(3-propan-2-yloxypropyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167928357 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 7-cyclopropyl-N-(3-propan-2-yloxypropyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)OCCCNc1ncnc2c1ccn2C1CC1 |
| InChI | InChI=1S/C15H22N4O/c1-11(2)20-9-3-7-16-14-13-6-8-19(12-4-5-12)15(13)18-10-17-14/h6,8,10-12H,3-5,7,9H2,1-2H3,(H,16,17,18) |
| InChIKey | HDWCLKNXBUJLCD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|