C37H32ClN — CID 154947441
3'-chloro-5'-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]spiro[cyclohexane-1,11'-indeno[1,2-b]carbazole] (PubChem CID 154947441) has the molecular formula C37H32ClN and a molecular weight of 526.12 g/mol. Its IUPAC name is 3'-chloro-5'-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]spiro[cyclohexane-1,11'-indeno[1,2-b]carbazole].
| Compound Name | 3'-chloro-5'-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]spiro[cyclohexane-1,11'-indeno[1,2-b]carbazole] |
|---|---|
| PubChem CID | 154947441 |
| Molecular Formula | C37H32ClN |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 3'-chloro-5'-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]spiro[cyclohexane-1,11'-indeno[1,2-b]carbazole] |
| SMILES | C=C/C=C\C=C(/C)c1ccc(-n2c3cc(Cl)ccc3c3cc4c(cc32)-c2ccccc2C42CCCCC2)cc1 |
| InChI | InChI=1S/C37H32ClN/c1-3-4-6-11-25(2)26-14-17-28(18-15-26)39-35-22-27(38)16-19-30(35)32-23-34-31(24-36(32)39)29-12-7-8-13-33(29)37(34)20-9-5-10-21-37/h3-4,6-8,11-19,22-24H,1,5,9-10,20-21H2,2H3/b6-4-,25-11+ |
| InChIKey | TZHHHEYMRBZHBZ-OPLRHUGGSA-N |
| XLogP | 10.81 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|