C26H51BSi4Sn — CID 15495134
(3-diethylboranyl-11-ethyl-5,5,7,7,9,9-hexamethyl-10-trimethylstannyl-5,7,9-trisilatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-4-yl)-trimethylsilane (PubChem CID 15495134) has the molecular formula C26H51BSi4Sn and a molecular weight of 605.56 g/mol. Its IUPAC name is (3-diethylboranyl-11-ethyl-5,5,7,7,9,9-hexamethyl-10-trimethylstannyl-5,7,9-trisilatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-4-yl)-trimethylsilane.
| Compound Name | (3-diethylboranyl-11-ethyl-5,5,7,7,9,9-hexamethyl-10-trimethylstannyl-5,7,9-trisilatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 15495134 |
| Molecular Formula | C26H51BSi4Sn |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | (3-diethylboranyl-11-ethyl-5,5,7,7,9,9-hexamethyl-10-trimethylstannyl-5,7,9-trisilatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-4-yl)-trimethylsilane |
| SMILES | CCB(CC)C1=C([Si](C)(C)C)[Si](C)(C)C2=C1C1=C([Si]2(C)C)[Si](C)(C)C([Sn](C)(C)C)=C1CC |
| InChI | InChI=1S/C23H42BSi4.3CH3.Sn/c1-13-17-16-26(7,8)21-18(17)19-20(24(14-2)15-3)23(25(4,5)6)28(11,12)22(19)27(21,9)10;;;;/h13-15H2,1-12H3;3*1H3; |
| InChIKey | HGJXHZLIWKGUDD-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|