C26H51BSi4Sn — CID 15495135
trimethyl-(3,11,12-triethyl-5,5,7,7,9,9-hexamethyl-4-trimethylstannyl-5,7,9-trisila-12-boratricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,10-tetraen-10-yl)silane (PubChem CID 15495135) has the molecular formula C26H51BSi4Sn and a molecular weight of 605.56 g/mol. Its IUPAC name is trimethyl-(3,11,12-triethyl-5,5,7,7,9,9-hexamethyl-4-trimethylstannyl-5,7,9-trisila-12-boratricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,10-tetraen-10-yl)silane.
| Compound Name | trimethyl-(3,11,12-triethyl-5,5,7,7,9,9-hexamethyl-4-trimethylstannyl-5,7,9-trisila-12-boratricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,10-tetraen-10-yl)silane |
|---|---|
| PubChem CID | 15495135 |
| Molecular Formula | C26H51BSi4Sn |
| Molecular Weight | 605.56 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | trimethyl-(3,11,12-triethyl-5,5,7,7,9,9-hexamethyl-4-trimethylstannyl-5,7,9-trisila-12-boratricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,10-tetraen-10-yl)silane |
| SMILES | CCB1C(CC)=C([Si](C)(C)C)[Si](C)(C)C2=C1C1=C([Si]2(C)C)[Si](C)(C)C([Sn](C)(C)C)=C1CC |
| InChI | InChI=1S/C23H42BSi4.3CH3.Sn/c1-13-17-16-26(7,8)22-19(17)20-23(28(22,11)12)27(9,10)21(25(4,5)6)18(14-2)24(20)15-3;;;;/h13-15H2,1-12H3;3*1H3; |
| InChIKey | HVMLEBZSYJBTRW-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.56 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|