C20H22ClN5O3 — CID 154953650
tert-butyl N-[(2S)-1-(4-azidoanilino)-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 154953650) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4-azidoanilino)-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(4-azidoanilino)-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 154953650 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4-azidoanilino)-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1Cl)C(=O)Nc1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H22ClN5O3/c1-20(2,3)29-19(28)24-17(12-13-6-4-5-7-16(13)21)18(27)23-14-8-10-15(11-9-14)25-26-22/h4-11,17H,12H2,1-3H3,(H,23,27)(H,24,28)/t17-/m0/s1 |
| InChIKey | SXOVIQVBMPVSSK-KRWDZBQOSA-N |
| XLogP | 5.36 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|