C16H21N5O2S2 — CID 154953781
ethyl 6-[(4-methanethioylpiperazin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 154953781) has the molecular formula C16H21N5O2S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is ethyl 6-[(4-methanethioylpiperazin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[(4-methanethioylpiperazin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 154953781 |
| Molecular Formula | C16H21N5O2S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | ethyl 6-[(4-methanethioylpiperazin-1-yl)methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CCN(C=S)CC2)NC(c2nccs2)=NC1 |
| InChI | InChI=1S/C16H21N5O2S2/c1-2-23-16(22)12-9-18-14(15-17-3-8-25-15)19-13(12)10-20-4-6-21(11-24)7-5-20/h3,8,11H,2,4-7,9-10H2,1H3,(H,18,19) |
| InChIKey | LLTDJHMVVAFUPZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|