C23H31N5O3S2 — CID 154953805
ethyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 154953805) has the molecular formula C23H31N5O3S2 and a molecular weight of 489.67 g/mol. Its IUPAC name is ethyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 154953805 |
| Molecular Formula | C23H31N5O3S2 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | ethyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CCN3C(=S)N(CC(C)(C)C=O)CC3C2)NC(c2nccs2)=CC1 |
| InChI | InChI=1S/C23H31N5O3S2/c1-4-31-21(30)17-5-6-18(20-24-7-10-33-20)25-19(17)13-26-8-9-28-16(11-26)12-27(22(28)32)14-23(2,3)15-29/h6-7,10,15-16,25H,4-5,8-9,11-14H2,1-3H3 |
| InChIKey | ARKSKSXFUDJVKR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|