C15H14FN5S2 — CID 154954780
4-[4-[2-fluoro-3-(methylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]pyrimidin-2-amine (PubChem CID 154954780) has the molecular formula C15H14FN5S2 and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-[4-[2-fluoro-3-(methylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | 4-[4-[2-fluoro-3-(methylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 154954780 |
| Molecular Formula | C15H14FN5S2 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-[4-[2-fluoro-3-(methylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]pyrimidin-2-amine |
| SMILES | CSNc1cccc(-c2nc(C)sc2-c2ccnc(N)n2)c1F |
| InChI | InChI=1S/C15H14FN5S2/c1-8-19-13(9-4-3-5-10(12(9)16)21-22-2)14(23-8)11-6-7-18-15(17)20-11/h3-7,21H,1-2H3,(H2,17,18,20) |
| InChIKey | SAYDNSGGDZHJDQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|