C21H19FN6O2S2 — CID 143891441
4-[4-[2-fluoro-3-(furan-2-ylsulfanylamino)phenyl]-2-morpholin-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine (PubChem CID 143891441) has the molecular formula C21H19FN6O2S2 and a molecular weight of 470.56 g/mol. Its IUPAC name is 4-[4-[2-fluoro-3-(furan-2-ylsulfanylamino)phenyl]-2-morpholin-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | 4-[4-[2-fluoro-3-(furan-2-ylsulfanylamino)phenyl]-2-morpholin-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143891441 |
| Molecular Formula | C21H19FN6O2S2 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 4-[4-[2-fluoro-3-(furan-2-ylsulfanylamino)phenyl]-2-morpholin-4-yl-1,3-thiazol-5-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2sc(N3CCOCC3)nc2-c2cccc(NSc3ccco3)c2F)n1 |
| InChI | InChI=1S/C21H19FN6O2S2/c22-17-13(3-1-4-14(17)27-32-16-5-2-10-30-16)18-19(15-6-7-24-20(23)25-15)31-21(26-18)28-8-11-29-12-9-28/h1-7,10,27H,8-9,11-12H2,(H2,23,24,25) |
| InChIKey | BYFNNDDIGDNINM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|