C23H17ClF3N5OS2 — CID 143891451
3-[5-(2-chloropyrimidin-4-yl)-2-morpholin-4-yl-1,3-thiazol-4-yl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoroaniline (PubChem CID 143891451) has the molecular formula C23H17ClF3N5OS2 and a molecular weight of 536.00 g/mol. Its IUPAC name is 3-[5-(2-chloropyrimidin-4-yl)-2-morpholin-4-yl-1,3-thiazol-4-yl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoroaniline.
| Compound Name | 3-[5-(2-chloropyrimidin-4-yl)-2-morpholin-4-yl-1,3-thiazol-4-yl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoroaniline |
|---|---|
| PubChem CID | 143891451 |
| Molecular Formula | C23H17ClF3N5OS2 |
| Molecular Weight | 536.00 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | 3-[5-(2-chloropyrimidin-4-yl)-2-morpholin-4-yl-1,3-thiazol-4-yl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoroaniline |
| SMILES | Fc1ccc(F)c(SNc2cccc(-c3nc(N4CCOCC4)sc3-c3ccnc(Cl)n3)c2F)c1 |
| InChI | InChI=1S/C23H17ClF3N5OS2/c24-22-28-7-6-17(29-22)21-20(30-23(34-21)32-8-10-33-11-9-32)14-2-1-3-16(19(14)27)31-35-18-12-13(25)4-5-15(18)26/h1-7,12,31H,8-11H2 |
| InChIKey | MXONCMFKTVAWAL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.00 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|