C20H22ClFN4S2 — CID 172569923
3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluoro-N-propylsulfanylaniline (PubChem CID 172569923) has the molecular formula C20H22ClFN4S2 and a molecular weight of 437.01 g/mol. Its IUPAC name is 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluoro-N-propylsulfanylaniline.
| Compound Name | 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluoro-N-propylsulfanylaniline |
|---|---|
| PubChem CID | 172569923 |
| Molecular Formula | C20H22ClFN4S2 |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluoro-N-propylsulfanylaniline |
| SMILES | CCCSNc1cccc(-c2nc(C(C)(C)C)sc2-c2ccnc(Cl)n2)c1F |
| InChI | InChI=1S/C20H22ClFN4S2/c1-5-11-27-26-13-8-6-7-12(15(13)22)16-17(14-9-10-23-19(21)24-14)28-18(25-16)20(2,3)4/h6-10,26H,5,11H2,1-4H3 |
| InChIKey | SNMQWXVEHVMMJV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|