C23H18ClF3N4S2 — CID 126676365
3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-N-(2,6-difluorophenyl)sulfanyl-2-fluoroaniline (PubChem CID 126676365) has the molecular formula C23H18ClF3N4S2 and a molecular weight of 507.01 g/mol. Its IUPAC name is 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-N-(2,6-difluorophenyl)sulfanyl-2-fluoroaniline.
| Compound Name | 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-N-(2,6-difluorophenyl)sulfanyl-2-fluoroaniline |
|---|---|
| PubChem CID | 126676365 |
| Molecular Formula | C23H18ClF3N4S2 |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-N-(2,6-difluorophenyl)sulfanyl-2-fluoroaniline |
| SMILES | CC(C)(C)c1nc(-c2cccc(NSc3c(F)cccc3F)c2F)c(-c2ccnc(Cl)n2)s1 |
| InChI | InChI=1S/C23H18ClF3N4S2/c1-23(2,3)21-30-18(20(32-21)16-10-11-28-22(24)29-16)12-6-4-9-15(17(12)27)31-33-19-13(25)7-5-8-14(19)26/h4-11,31H,1-3H3 |
| InChIKey | APDFYKFNJZSLDF-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|