C22H26FN5O2S2 — CID 172570001
2-[[4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]acetic acid (PubChem CID 172570001) has the molecular formula C22H26FN5O2S2 and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-[[4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]acetic acid.
| Compound Name | 2-[[4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 172570001 |
| Molecular Formula | C22H26FN5O2S2 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[[4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]acetic acid |
| SMILES | CCCSNc1cccc(-c2nc(C(C)(C)C)sc2-c2ccnc(NCC(=O)O)n2)c1F |
| InChI | InChI=1S/C22H26FN5O2S2/c1-5-11-31-28-14-8-6-7-13(17(14)23)18-19(32-20(27-18)22(2,3)4)15-9-10-24-21(26-15)25-12-16(29)30/h6-10,28H,5,11-12H2,1-4H3,(H,29,30)(H,24,25,26) |
| InChIKey | QXYJHFWWWRYGIV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|