C30H42FN7S2 — CID 172570309
4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpiperidin-4-yl)pyrimidin-2-amine (PubChem CID 172570309) has the molecular formula C30H42FN7S2 and a molecular weight of 583.85 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpiperidin-4-yl)pyrimidin-2-amine.
| Compound Name | 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpiperidin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 172570309 |
| Molecular Formula | C30H42FN7S2 |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpiperidin-4-yl)pyrimidin-2-amine |
| SMILES | CCCSNc1cccc(-c2nc(C(C)(C)C)sc2-c2ccnc(NC3CCN(C4CCNCC4)CC3)n2)c1F |
| InChI | InChI=1S/C30H42FN7S2/c1-5-19-39-37-23-8-6-7-22(25(23)31)26-27(40-28(36-26)30(2,3)4)24-11-16-33-29(35-24)34-20-12-17-38(18-13-20)21-9-14-32-15-10-21/h6-8,11,16,20-21,32,37H,5,9-10,12-15,17-19H2,1-4H3,(H,33,34,35) |
| InChIKey | FXHTVFWCIBOJFU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|