C32H39FN6S2 — CID 172570458
4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-[4-(1-methylpiperidin-4-yl)phenyl]pyrimidin-2-amine (PubChem CID 172570458) has the molecular formula C32H39FN6S2 and a molecular weight of 590.84 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-[4-(1-methylpiperidin-4-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-[4-(1-methylpiperidin-4-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 172570458 |
| Molecular Formula | C32H39FN6S2 |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-[4-(1-methylpiperidin-4-yl)phenyl]pyrimidin-2-amine |
| SMILES | CCCSNc1cccc(-c2nc(C(C)(C)C)sc2-c2ccnc(Nc3ccc(C4CCN(C)CC4)cc3)n2)c1F |
| InChI | InChI=1S/C32H39FN6S2/c1-6-20-40-38-25-9-7-8-24(27(25)33)28-29(41-30(37-28)32(2,3)4)26-14-17-34-31(36-26)35-23-12-10-21(11-13-23)22-15-18-39(5)19-16-22/h7-14,17,22,38H,6,15-16,18-20H2,1-5H3,(H,34,35,36) |
| InChIKey | QQYRENZXURNSNK-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|