C23H22FN5S — CID 134367040
4-[4-(3-amino-2-fluorophenyl)-2-tert-butyl-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine (PubChem CID 134367040) has the molecular formula C23H22FN5S and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[4-(3-amino-2-fluorophenyl)-2-tert-butyl-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine.
| Compound Name | 4-[4-(3-amino-2-fluorophenyl)-2-tert-butyl-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 134367040 |
| Molecular Formula | C23H22FN5S |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[4-(3-amino-2-fluorophenyl)-2-tert-butyl-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine |
| SMILES | CC(C)(C)c1nc(-c2cccc(N)c2F)c(-c2ccnc(Nc3ccccc3)n2)s1 |
| InChI | InChI=1S/C23H22FN5S/c1-23(2,3)21-29-19(15-10-7-11-16(25)18(15)24)20(30-21)17-12-13-26-22(28-17)27-14-8-5-4-6-9-14/h4-13H,25H2,1-3H3,(H,26,27,28) |
| InChIKey | ZDCMSOOLFSKNPY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|