C26H25F4N5S2 — CID 139449562
4-[2-tert-butyl-4-[2-fluoro-3-(3,3,3-trifluoropropylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine (PubChem CID 139449562) has the molecular formula C26H25F4N5S2 and a molecular weight of 547.65 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-fluoro-3-(3,3,3-trifluoropropylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine.
| Compound Name | 4-[2-tert-butyl-4-[2-fluoro-3-(3,3,3-trifluoropropylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 139449562 |
| Molecular Formula | C26H25F4N5S2 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-fluoro-3-(3,3,3-trifluoropropylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-phenylpyrimidin-2-amine |
| SMILES | CC(C)(C)c1nc(-c2cccc(NSCCC(F)(F)F)c2F)c(-c2ccnc(Nc3ccccc3)n2)s1 |
| InChI | InChI=1S/C26H25F4N5S2/c1-25(2,3)23-34-21(17-10-7-11-18(20(17)27)35-36-15-13-26(28,29)30)22(37-23)19-12-14-31-24(33-19)32-16-8-5-4-6-9-16/h4-12,14,35H,13,15H2,1-3H3,(H,31,32,33) |
| InChIKey | UARDYFDDPFIWQJ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|