C31H34FN6O2S2- — CID 172570416
CID 172570416 (PubChem CID 172570416) has the molecular formula C31H34FN6O2S2- and a molecular weight of 605.79 g/mol.
| Compound Name | CID 172570416 |
|---|---|
| PubChem CID | 172570416 |
| Molecular Formula | C31H34FN6O2S2- |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | — |
| SMILES | C=[S-](=O)Nc1cccc(-c2nc(C(C)(C)C)sc2-c2ccnc(Nc3ccc(C4CCN(C(C)=O)CC4)cc3)n2)c1F |
| InChI | InChI=1S/C31H34FN6O2S2/c1-19(39)38-17-14-21(15-18-38)20-9-11-22(12-10-20)34-30-33-16-13-25(35-30)28-27(36-29(41-28)31(2,3)4)23-7-6-8-24(26(23)32)37-42(5)40/h6-13,16,21H,5,14-15,17-18H2,1-4H3,(H,37,40)(H,33,34,35)/q-1 |
| InChIKey | KDNJZSJFSMEZKK-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|