C17H15Cl2FN4S — CID 176827224
3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-5-chloro-2-fluoroaniline (PubChem CID 176827224) has the molecular formula C17H15Cl2FN4S and a molecular weight of 397.31 g/mol. Its IUPAC name is 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-5-chloro-2-fluoroaniline.
| Compound Name | 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-5-chloro-2-fluoroaniline |
|---|---|
| PubChem CID | 176827224 |
| Molecular Formula | C17H15Cl2FN4S |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 3-[2-tert-butyl-5-(2-chloropyrimidin-4-yl)-1,3-thiazol-4-yl]-5-chloro-2-fluoroaniline |
| SMILES | CC(C)(C)c1nc(-c2cc(Cl)cc(N)c2F)c(-c2ccnc(Cl)n2)s1 |
| InChI | InChI=1S/C17H15Cl2FN4S/c1-17(2,3)15-24-13(9-6-8(18)7-10(21)12(9)20)14(25-15)11-4-5-22-16(19)23-11/h4-7H,21H2,1-3H3 |
| InChIKey | IVOBYOYKQQATJP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|