C18H22O2S — CID 154955361
1-(benzenesulfonyl)-4-(2,3-dimethylbutyl)benzene (PubChem CID 154955361) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(2,3-dimethylbutyl)benzene.
| Compound Name | 1-(benzenesulfonyl)-4-(2,3-dimethylbutyl)benzene |
|---|---|
| PubChem CID | 154955361 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(2,3-dimethylbutyl)benzene |
| SMILES | CC(C)C(C)Cc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22O2S/c1-14(2)15(3)13-16-9-11-18(12-10-16)21(19,20)17-7-5-4-6-8-17/h4-12,14-15H,13H2,1-3H3 |
| InChIKey | ZAGIXFHUGVPKKL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |