About [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite
[4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite (PubChem CID 172699258) has the molecular formula C15H17O5PS
and a molecular weight of 340.34 g/mol. Its IUPAC name is [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite.
Molecular Properties
| Compound Name | [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite |
| PubChem CID | 172699258 |
| Molecular Formula | C15H17O5PS |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite |
| SMILES | COP(OC)OCc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H17O5PS/c1-18-21(19-2)20-12-13-8-10-15(11-9-13)22(16,17)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
| InChIKey | CSWSGIZAJYXZSJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite?
The IUPAC name of [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite (CID 172699258) is [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite.
What is the SMILES notation for [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite?
The canonical SMILES for [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite is COP(OC)OCc1ccc(S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite?
The InChIKey is CSWSGIZAJYXZSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17O5PS/c1-18-21(19-2)20-12-13-8-10-15(11-9-13)22(16,17)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3.
What are the key properties of [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite?
[4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite has a molecular weight of 340.34 g/mol, XLogP of 3.56, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfonyl)phenyl]methyl dimethyl phosphite is sourced from PubChem (CID 172699258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).