C22H23FN6 — CID 154956270
5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 154956270) has the molecular formula C22H23FN6 and a molecular weight of 390.47 g/mol. Its IUPAC name is 5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 154956270 |
| Molecular Formula | C22H23FN6 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 5-fluoro-N-[(2S,3S)-3-methyl-2-bicyclo[2.2.2]octanyl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C[C@H]1C2CCC(CC2)[C@@H]1Nc1nc(-c2c[nH]c3ncccc23)nn2ccc(F)c12 |
| InChI | InChI=1S/C22H23FN6/c1-12-13-4-6-14(7-5-13)18(12)26-22-19-17(23)8-10-29(19)28-21(27-22)16-11-25-20-15(16)3-2-9-24-20/h2-3,8-14,18H,4-7H2,1H3,(H,24,25)(H,26,27,28)/t12-,13?,14?,18+/m0/s1 |
| InChIKey | PUHKDRCLZSVOAX-SEBUGHOLSA-N |
| XLogP | 4.65 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |