C10H13N3O4 — CID 154962551
4-amino-1-[4-hydroxy-3-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-6-yl]pyrimidin-2-one (PubChem CID 154962551) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-amino-1-[4-hydroxy-3-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-6-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[4-hydroxy-3-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-6-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 154962551 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-amino-1-[4-hydroxy-3-(hydroxymethyl)-2-oxabicyclo[3.1.0]hexan-6-yl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2C3OC(CO)C(O)C32)c(=O)n1 |
| InChI | InChI=1S/C10H13N3O4/c11-5-1-2-13(10(16)12-5)7-6-8(15)4(3-14)17-9(6)7/h1-2,4,6-9,14-15H,3H2,(H2,11,12,16) |
| InChIKey | CKIRGALBWXIFMP-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |