C11H17NO3 — CID 154963271
2-tert-butyl-2-ethynylmorpholine-4-carboxylic acid (PubChem CID 154963271) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-tert-butyl-2-ethynylmorpholine-4-carboxylic acid.
| Compound Name | 2-tert-butyl-2-ethynylmorpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 154963271 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-tert-butyl-2-ethynylmorpholine-4-carboxylic acid |
| SMILES | C#CC1(C(C)(C)C)CN(C(=O)O)CCO1 |
| InChI | InChI=1S/C11H17NO3/c1-5-11(10(2,3)4)8-12(9(13)14)6-7-15-11/h1H,6-8H2,2-4H3,(H,13,14) |
| InChIKey | BSCIBDOLCHGVHG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|