C9H15NO3 — CID 139347170
4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid (PubChem CID 139347170) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid.
| Compound Name | 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid |
|---|---|
| PubChem CID | 139347170 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid |
| SMILES | CC1(C)CN(C(=O)O)CCC12CO2 |
| InChI | InChI=1S/C9H15NO3/c1-8(2)5-10(7(11)12)4-3-9(8)6-13-9/h3-6H2,1-2H3,(H,11,12) |
| InChIKey | IMAVMJVDFVPPHN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|