4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid

C9H15NO3 — CID 139347170

IUPAC4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid
SMILESCC1(C)CN(C(=O)O)CCC12CO2
InChIInChI=1S/C9H15NO3/c1-8(2)5-10(7(11)12)4-3-9(8)6-13-9/h3-6H2,1-2H3,(H,11,12)
InChIKeyIMAVMJVDFVPPHN-UHFFFAOYSA-N
MW185.22 g/mol
LogP1.17
Rot. Bonds

About 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid

4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid (PubChem CID 139347170) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid.

Molecular Properties

Compound Name4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid
PubChem CID139347170
Molecular FormulaC9H15NO3
Molecular Weight185.22 g/mol
Exact Mass185.11
IUPAC Name4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid
SMILESCC1(C)CN(C(=O)O)CCC12CO2
InChIInChI=1S/C9H15NO3/c1-8(2)5-10(7(11)12)4-3-9(8)6-13-9/h3-6H2,1-2H3,(H,11,12)
InChIKeyIMAVMJVDFVPPHN-UHFFFAOYSA-N
XLogP1.17
TPSA53.07 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.22
LogP ≤ 51.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid?
The IUPAC name of 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid (CID 139347170) is 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid.
What is the SMILES notation for 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid?
The canonical SMILES for 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid is CC1(C)CN(C(=O)O)CCC12CO2.
What is the InChIKey of 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid?
The InChIKey is IMAVMJVDFVPPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-8(2)5-10(7(11)12)4-3-9(8)6-13-9/h3-6H2,1-2H3,(H,11,12).
What are the key properties of 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid?
4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid has a molecular weight of 185.22 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylic acid is sourced from PubChem (CID 139347170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).