About 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid
3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid (PubChem CID 156538627) has the molecular formula C8H14FNO3
and a molecular weight of 191.20 g/mol. Its IUPAC name is 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid.
Analyze 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid?
The IUPAC name of 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid (CID 156538627) is 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid.
What is the SMILES notation for 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid?
The canonical SMILES for 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid is CC1(O)CCN(C(=O)O)CC1(C)F.
What is the InChIKey of 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid?
The InChIKey is BTGAWSMYDOFOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FNO3/c1-7(9)5-10(6(11)12)4-3-8(7,2)13/h13H,3-5H2,1-2H3,(H,11,12).
What are the key properties of 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid?
3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid has a molecular weight of 191.20 g/mol, XLogP of 0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-hydroxy-3,4-dimethylpiperidine-1-carboxylic acid is sourced from PubChem (CID 156538627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).