C5H5ClFN — CID 154964853
4-chloro-5-fluoro-1,2-dihydropyridine (PubChem CID 154964853) has the molecular formula C5H5ClFN and a molecular weight of 133.55 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1,2-dihydropyridine.
| Compound Name | 4-chloro-5-fluoro-1,2-dihydropyridine |
|---|---|
| PubChem CID | 154964853 |
| Molecular Formula | C5H5ClFN |
| Molecular Weight | 133.55 g/mol |
| Exact Mass | 133.01 |
| IUPAC Name | 4-chloro-5-fluoro-1,2-dihydropyridine |
| SMILES | FC1=CNCC=C1Cl |
| InChI | InChI=1S/C5H5ClFN/c6-4-1-2-8-3-5(4)7/h1,3,8H,2H2 |
| InChIKey | ADPQFEPOIUGMGI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |