About 6-chloro-3-fluoro-1,2-dihydropyridine
6-chloro-3-fluoro-1,2-dihydropyridine (PubChem CID 173050584) has the molecular formula C5H5ClFN
and a molecular weight of 133.55 g/mol. Its IUPAC name is 6-chloro-3-fluoro-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 6-chloro-3-fluoro-1,2-dihydropyridine |
| PubChem CID | 173050584 |
| Molecular Formula | C5H5ClFN |
| Molecular Weight | 133.55 g/mol |
| Exact Mass | 133.01 |
| IUPAC Name | 6-chloro-3-fluoro-1,2-dihydropyridine |
| SMILES | FC1=CC=C(Cl)NC1 |
| InChI | InChI=1S/C5H5ClFN/c6-5-2-1-4(7)3-8-5/h1-2,8H,3H2 |
| InChIKey | YFLQWXGTOARHMR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-fluoro-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-fluoro-1,2-dihydropyridine?
The IUPAC name of 6-chloro-3-fluoro-1,2-dihydropyridine (CID 173050584) is 6-chloro-3-fluoro-1,2-dihydropyridine.
What is the SMILES notation for 6-chloro-3-fluoro-1,2-dihydropyridine?
The canonical SMILES for 6-chloro-3-fluoro-1,2-dihydropyridine is FC1=CC=C(Cl)NC1.
What is the InChIKey of 6-chloro-3-fluoro-1,2-dihydropyridine?
The InChIKey is YFLQWXGTOARHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClFN/c6-5-2-1-4(7)3-8-5/h1-2,8H,3H2.
What are the key properties of 6-chloro-3-fluoro-1,2-dihydropyridine?
6-chloro-3-fluoro-1,2-dihydropyridine has a molecular weight of 133.55 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-fluoro-1,2-dihydropyridine is sourced from PubChem (CID 173050584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).