C6H7ClFN — CID 163850809
6-chloro-5-fluoro-3-methyl-1,2-dihydropyridine (PubChem CID 163850809) has the molecular formula C6H7ClFN and a molecular weight of 147.58 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-methyl-1,2-dihydropyridine.
| Compound Name | 6-chloro-5-fluoro-3-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 163850809 |
| Molecular Formula | C6H7ClFN |
| Molecular Weight | 147.58 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 6-chloro-5-fluoro-3-methyl-1,2-dihydropyridine |
| SMILES | CC1=CC(F)=C(Cl)NC1 |
| InChI | InChI=1S/C6H7ClFN/c1-4-2-5(8)6(7)9-3-4/h2,9H,3H2,1H3 |
| InChIKey | OUEIKHODMUFMEH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|