C7H12ClN — CID 142510236
(2E)-4-chloro-N,2-dimethylpenta-2,4-dien-1-amine (PubChem CID 142510236) has the molecular formula C7H12ClN and a molecular weight of 145.63 g/mol. Its IUPAC name is (2E)-4-chloro-N,2-dimethylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-4-chloro-N,2-dimethylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142510236 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (2E)-4-chloro-N,2-dimethylpenta-2,4-dien-1-amine |
| SMILES | C=C(Cl)/C=C(\C)CNC |
| InChI | InChI=1S/C7H12ClN/c1-6(5-9-3)4-7(2)8/h4,9H,2,5H2,1,3H3/b6-4+ |
| InChIKey | ZTCSMVAWKXHBDR-GQCTYLIASA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|