C10H14ClN — CID 123567614
5-chloro-N-methyl-2-propa-1,2-dienylhexa-2,4-dien-1-amine (PubChem CID 123567614) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is 5-chloro-N-methyl-2-propa-1,2-dienylhexa-2,4-dien-1-amine.
| Compound Name | 5-chloro-N-methyl-2-propa-1,2-dienylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123567614 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 5-chloro-N-methyl-2-propa-1,2-dienylhexa-2,4-dien-1-amine |
| SMILES | C=C=CC(=CC=C(C)Cl)CNC |
| InChI | InChI=1S/C10H14ClN/c1-4-5-10(8-12-3)7-6-9(2)11/h5-7,12H,1,8H2,2-3H3 |
| InChIKey | VLLOPGJQZWNVPB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|