C7H12F2N2 — CID 154967768
N-[(E)-[(E)-3,5-difluorohex-3-en-2-ylidene]amino]methanamine (PubChem CID 154967768) has the molecular formula C7H12F2N2 and a molecular weight of 162.18 g/mol. Its IUPAC name is N-[(E)-[(E)-3,5-difluorohex-3-en-2-ylidene]amino]methanamine.
| Compound Name | N-[(E)-[(E)-3,5-difluorohex-3-en-2-ylidene]amino]methanamine |
|---|---|
| PubChem CID | 154967768 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | N-[(E)-[(E)-3,5-difluorohex-3-en-2-ylidene]amino]methanamine |
| SMILES | CN/N=C(C)/C(F)=C\C(C)F |
| InChI | InChI=1S/C7H12F2N2/c1-5(8)4-7(9)6(2)11-10-3/h4-5,10H,1-3H3/b7-4+,11-6+ |
| InChIKey | ISLNUJZAQGGWEV-UTJSZMBVSA-N |
| XLogP | 1.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|