C6H9F2IN2 — CID 172959955
N-[(E)-[(Z)-1,1-difluoropent-3-en-2-ylidene]amino]-1-iodomethanamine (PubChem CID 172959955) has the molecular formula C6H9F2IN2 and a molecular weight of 274.05 g/mol. Its IUPAC name is N-[(E)-[(Z)-1,1-difluoropent-3-en-2-ylidene]amino]-1-iodomethanamine.
| Compound Name | N-[(E)-[(Z)-1,1-difluoropent-3-en-2-ylidene]amino]-1-iodomethanamine |
|---|---|
| PubChem CID | 172959955 |
| Molecular Formula | C6H9F2IN2 |
| Molecular Weight | 274.05 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | N-[(E)-[(Z)-1,1-difluoropent-3-en-2-ylidene]amino]-1-iodomethanamine |
| SMILES | C/C=C\C(=N/NCI)C(F)F |
| InChI | InChI=1S/C6H9F2IN2/c1-2-3-5(6(7)8)11-10-4-9/h2-3,6,10H,4H2,1H3/b3-2-,11-5+ |
| InChIKey | NYKKOHCYHBSPRP-OKBMCRLZSA-N |
| XLogP | 2.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.05 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|