C24H25N5O3 — CID 154970389
N-[2-[3-(2-hydroxypropan-2-yl)cyclobutyl]-6-methoxyindazol-5-yl]quinoxaline-2-carboxamide (PubChem CID 154970389) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[2-[3-(2-hydroxypropan-2-yl)cyclobutyl]-6-methoxyindazol-5-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[2-[3-(2-hydroxypropan-2-yl)cyclobutyl]-6-methoxyindazol-5-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 154970389 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[2-[3-(2-hydroxypropan-2-yl)cyclobutyl]-6-methoxyindazol-5-yl]quinoxaline-2-carboxamide |
| SMILES | COc1cc2nn(C3CC(C(C)(C)O)C3)cc2cc1NC(=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C24H25N5O3/c1-24(2,31)15-9-16(10-15)29-13-14-8-20(22(32-3)11-19(14)28-29)27-23(30)21-12-25-17-6-4-5-7-18(17)26-21/h4-8,11-13,15-16,31H,9-10H2,1-3H3,(H,27,30) |
| InChIKey | LPROJANEQWGVJZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |