C17H14ClN3O3 — CID 17433781
N-(4-chloro-2,5-dimethoxyphenyl)quinoxaline-2-carboxamide (PubChem CID 17433781) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)quinoxaline-2-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 17433781 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)quinoxaline-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cnc3ccccc3n2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H14ClN3O3/c1-23-15-8-13(16(24-2)7-10(15)18)21-17(22)14-9-19-11-5-3-4-6-12(11)20-14/h3-9H,1-2H3,(H,21,22) |
| InChIKey | NUYQSFYMFLYQDU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |