C24H27N3O2 — CID 154972404
N-methyl-N-[(1E,3E)-4-methyl-2-[2-oxo-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-6-yl]hexa-1,3-dienyl]formamide (PubChem CID 154972404) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-methyl-N-[(1E,3E)-4-methyl-2-[2-oxo-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-6-yl]hexa-1,3-dienyl]formamide.
| Compound Name | N-methyl-N-[(1E,3E)-4-methyl-2-[2-oxo-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-6-yl]hexa-1,3-dienyl]formamide |
|---|---|
| PubChem CID | 154972404 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-methyl-N-[(1E,3E)-4-methyl-2-[2-oxo-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-6-yl]hexa-1,3-dienyl]formamide |
| SMILES | CC/C(C)=C/C(=C\N(C)C=O)c1cc2c(cc1Cc1ccccn1)NC(=O)CC2 |
| InChI | InChI=1S/C24H27N3O2/c1-4-17(2)11-20(15-27(3)16-28)22-13-18-8-9-24(29)26-23(18)14-19(22)12-21-7-5-6-10-25-21/h5-7,10-11,13-16H,4,8-9,12H2,1-3H3,(H,26,29)/b17-11+,20-15+ |
| InChIKey | QIQBANKAGSEFHF-IXKPFFITSA-N |
| XLogP | 4.34 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|