C30H32BCl2N3O4 — CID 158423562
6-chloro-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one;6-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 158423562) has the molecular formula C30H32BCl2N3O4 and a molecular weight of 580.32 g/mol. Its IUPAC name is 6-chloro-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one;6-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-chloro-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one;6-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 158423562 |
| Molecular Formula | C30H32BCl2N3O4 |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 6-chloro-7-(pyridin-2-ylmethyl)-3,4-dihydro-1H-quinolin-2-one;6-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC1(C)OB(c2cc3c(cc2Cl)CCC(=O)N3)OC1(C)C.O=C1CCc2cc(Cl)c(Cc3ccccn3)cc2N1 |
| InChI | InChI=1S/C15H19BClNO3.C15H13ClN2O/c1-14(2)15(3,4)21-16(20-14)10-8-12-9(7-11(10)17)5-6-13(19)18-12;16-13-8-10-4-5-15(19)18-14(10)9-11(13)7-12-3-1-2-6-17-12/h7-8H,5-6H2,1-4H3,(H,18,19);1-3,6,8-9H,4-5,7H2,(H,18,19) |
| InChIKey | HATVTZJCSDKPSF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|