C45H44O11 — CID 154972574
2-[6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one (PubChem CID 154972574) has the molecular formula C45H44O11 and a molecular weight of 760.84 g/mol. Its IUPAC name is 2-[6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one.
| Compound Name | 2-[6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one |
|---|---|
| PubChem CID | 154972574 |
| Molecular Formula | C45H44O11 |
| Molecular Weight | 760.84 g/mol |
| Exact Mass | 760.29 |
| IUPAC Name | 2-[6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one |
| SMILES | CC(C)=CCc1c(O)c(C2C=C(C)CC(c3ccc(O)cc3O)C2C(=O)c2ccc(O)cc2O)c(O)c2c1OC1(CC=C(C)C)c3ccc(O)cc3OC1C2=O |
| InChI | InChI=1S/C45H44O11/c1-21(2)6-10-29-40(52)37(41(53)38-42(54)44-45(56-43(29)38,15-14-22(3)4)32-13-9-26(48)20-35(32)55-44)31-17-23(5)16-30(27-11-7-24(46)18-33(27)49)36(31)39(51)28-12-8-25(47)19-34(28)50/h6-9,11-14,17-20,30-31,36,44,46-50,52-53H,10,15-16H2,1-5H3 |
| InChIKey | AYDSJSYGKWMIJQ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.84 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|