C46H48O11 — CID 154972575
2-[(Z)-1,7-bis(2,4-dihydroxyphenyl)-5-methyl-1-oxooct-4-en-3-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one (PubChem CID 154972575) has the molecular formula C46H48O11 and a molecular weight of 776.88 g/mol. Its IUPAC name is 2-[(Z)-1,7-bis(2,4-dihydroxyphenyl)-5-methyl-1-oxooct-4-en-3-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one.
| Compound Name | 2-[(Z)-1,7-bis(2,4-dihydroxyphenyl)-5-methyl-1-oxooct-4-en-3-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one |
|---|---|
| PubChem CID | 154972575 |
| Molecular Formula | C46H48O11 |
| Molecular Weight | 776.88 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | 2-[(Z)-1,7-bis(2,4-dihydroxyphenyl)-5-methyl-1-oxooct-4-en-3-yl]-1,3,8-trihydroxy-4,5a-bis(3-methylbut-2-enyl)-10aH-[1]benzofuro[3,2-b]chromen-11-one |
| SMILES | CC(C)=CCc1c(O)c(C(/C=C(/C)CC(C)c2ccc(O)cc2O)CC(=O)c2ccc(O)cc2O)c(O)c2c1OC1(CC=C(C)C)c3ccc(O)cc3OC1C2=O |
| InChI | InChI=1S/C46H48O11/c1-23(2)7-11-33-41(53)39(42(54)40-43(55)45-46(57-44(33)40,16-15-24(3)4)34-14-10-30(49)22-38(34)56-45)27(19-35(50)32-13-9-29(48)21-37(32)52)18-25(5)17-26(6)31-12-8-28(47)20-36(31)51/h7-10,12-15,18,20-22,26-27,45,47-49,51-54H,11,16-17,19H2,1-6H3/b25-18- |
| InChIKey | JGDXNEINWIRXJJ-BWAHOGKJSA-N |
| XLogP | 9.22 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.88 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|