C55H44N2 — CID 154972655
N-[3-(3-cyclohexa-1,5-dien-1-ylphenyl)phenyl]-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-[3-(3-phenylphenyl)phenyl]carbazol-4-amine (PubChem CID 154972655) has the molecular formula C55H44N2 and a molecular weight of 732.97 g/mol. Its IUPAC name is N-[3-(3-cyclohexa-1,5-dien-1-ylphenyl)phenyl]-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-[3-(3-phenylphenyl)phenyl]carbazol-4-amine.
| Compound Name | N-[3-(3-cyclohexa-1,5-dien-1-ylphenyl)phenyl]-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-[3-(3-phenylphenyl)phenyl]carbazol-4-amine |
|---|---|
| PubChem CID | 154972655 |
| Molecular Formula | C55H44N2 |
| Molecular Weight | 732.97 g/mol |
| Exact Mass | 732.35 |
| IUPAC Name | N-[3-(3-cyclohexa-1,5-dien-1-ylphenyl)phenyl]-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-[3-(3-phenylphenyl)phenyl]carbazol-4-amine |
| SMILES | C=C(/C=C\C=C/C)c1ccc2c(c1Nc1cccc(-c3cccc(C4=CCCC=C4)c3)c1)c1ccccc1n2-c1cccc(-c2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C55H44N2/c1-3-4-7-18-39(2)50-33-34-53-54(55(50)56-48-29-16-27-46(37-48)44-25-14-23-42(35-44)40-19-8-5-9-20-40)51-31-12-13-32-52(51)57(53)49-30-17-28-47(38-49)45-26-15-24-43(36-45)41-21-10-6-11-22-41/h3-4,6-8,10-38,56H,2,5,9H2,1H3/b4-3-,18-7- |
| InChIKey | XWFAWUVAVBFQES-WBEPSJDQSA-N |
| XLogP | 15.41 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.97 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|