C21H28N2O5 — CID 15497313
dimethyl 1-[di(propan-2-yl)amino]-2-(4-methylphenyl)-5-oxo-2H-pyrrole-3,4-dicarboxylate (PubChem CID 15497313) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is dimethyl 1-[di(propan-2-yl)amino]-2-(4-methylphenyl)-5-oxo-2H-pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-[di(propan-2-yl)amino]-2-(4-methylphenyl)-5-oxo-2H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15497313 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | dimethyl 1-[di(propan-2-yl)amino]-2-(4-methylphenyl)-5-oxo-2H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccc(C)cc2)N(N(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C21H28N2O5/c1-12(2)22(13(3)4)23-18(15-10-8-14(5)9-11-15)16(20(25)27-6)17(19(23)24)21(26)28-7/h8-13,18H,1-7H3 |
| InChIKey | DMPCEPJHOIXDRU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|