C30H33N6O3S- — CID 154975692
CID 154975692 (PubChem CID 154975692) has the molecular formula C30H33N6O3S- and a molecular weight of 557.70 g/mol.
| Compound Name | CID 154975692 |
|---|---|
| PubChem CID | 154975692 |
| Molecular Formula | C30H33N6O3S- |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccccc1N1CCN(C(=O)c2cc(NC3CCN(c4ccccc4C#N)CC3)c(O)cc2C)CC1 |
| InChI | InChI=1S/C30H33N6O3S/c1-21-18-28(37)25(33-23-10-12-34(13-11-23)26-7-3-2-6-22(26)20-31)19-24(21)30(38)36-16-14-35(15-17-36)27-8-4-5-9-29(27)40(32)39/h2-9,18-19,23,32-33,37H,10-17H2,1H3/q-1 |
| InChIKey | VJUSKRYHIJUDDB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|