C24H31N3O4 — CID 154976939
5-[3-(2-ethoxy-2-hydroxypropyl)-2-(oxan-4-yl)benzimidazol-5-yl]-1,3-dimethylpyridin-2-one (PubChem CID 154976939) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 5-[3-(2-ethoxy-2-hydroxypropyl)-2-(oxan-4-yl)benzimidazol-5-yl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[3-(2-ethoxy-2-hydroxypropyl)-2-(oxan-4-yl)benzimidazol-5-yl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 154976939 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 5-[3-(2-ethoxy-2-hydroxypropyl)-2-(oxan-4-yl)benzimidazol-5-yl]-1,3-dimethylpyridin-2-one |
| SMILES | CCOC(C)(O)Cn1c(C2CCOCC2)nc2ccc(-c3cc(C)c(=O)n(C)c3)cc21 |
| InChI | InChI=1S/C24H31N3O4/c1-5-31-24(3,29)15-27-21-13-18(19-12-16(2)23(28)26(4)14-19)6-7-20(21)25-22(27)17-8-10-30-11-9-17/h6-7,12-14,17,29H,5,8-11,15H2,1-4H3 |
| InChIKey | GHCYWXDUHQXPQA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|