C28H38N4O5 — CID 176893483
tert-butyl N-[2-[2-[6-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(oxan-4-yl)benzimidazol-1-yl]ethoxy]ethyl]carbamate (PubChem CID 176893483) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[6-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(oxan-4-yl)benzimidazol-1-yl]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[6-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(oxan-4-yl)benzimidazol-1-yl]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176893483 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | tert-butyl N-[2-[2-[6-(1,5-dimethyl-6-oxo-3-pyridinyl)-2-(oxan-4-yl)benzimidazol-1-yl]ethoxy]ethyl]carbamate |
| SMILES | Cc1cc(-c2ccc3nc(C4CCOCC4)n(CCOCCNC(=O)OC(C)(C)C)c3c2)cn(C)c1=O |
| InChI | InChI=1S/C28H38N4O5/c1-19-16-22(18-31(5)26(19)33)21-6-7-23-24(17-21)32(25(30-23)20-8-12-35-13-9-20)11-15-36-14-10-29-27(34)37-28(2,3)4/h6-7,16-18,20H,8-15H2,1-5H3,(H,29,34) |
| InChIKey | ATSZONSRFCCEMD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|