C25H33BrN4O6 — CID 166564799
tert-butyl N-[2-[2-[2-[6-bromo-4-oxo-2-(1-prop-2-enoylazetidin-3-yl)quinazolin-3-yl]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 166564799) has the molecular formula C25H33BrN4O6 and a molecular weight of 565.47 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[6-bromo-4-oxo-2-(1-prop-2-enoylazetidin-3-yl)quinazolin-3-yl]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[6-bromo-4-oxo-2-(1-prop-2-enoylazetidin-3-yl)quinazolin-3-yl]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166564799 |
| Molecular Formula | C25H33BrN4O6 |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[6-bromo-4-oxo-2-(1-prop-2-enoylazetidin-3-yl)quinazolin-3-yl]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | C=CC(=O)N1CC(c2nc3ccc(Br)cc3c(=O)n2CCOCCOCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H33BrN4O6/c1-5-21(31)29-15-17(16-29)22-28-20-7-6-18(26)14-19(20)23(32)30(22)9-11-35-13-12-34-10-8-27-24(33)36-25(2,3)4/h5-7,14,17H,1,8-13,15-16H2,2-4H3,(H,27,33) |
| InChIKey | KGSQXYJOMWEICN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|