C26H19NOS — CID 154979971
10-ethenyl-5-phenyl-9-[(Z)-prop-1-enyl]thieno[2,3-j]phenanthridin-6-one (PubChem CID 154979971) has the molecular formula C26H19NOS and a molecular weight of 393.51 g/mol. Its IUPAC name is 10-ethenyl-5-phenyl-9-[(Z)-prop-1-enyl]thieno[2,3-j]phenanthridin-6-one.
| Compound Name | 10-ethenyl-5-phenyl-9-[(Z)-prop-1-enyl]thieno[2,3-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 154979971 |
| Molecular Formula | C26H19NOS |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 10-ethenyl-5-phenyl-9-[(Z)-prop-1-enyl]thieno[2,3-j]phenanthridin-6-one |
| SMILES | C=Cc1c(/C=C\C)sc2cc3c(=O)n(-c4ccccc4)c4ccccc4c3cc12 |
| InChI | InChI=1S/C26H19NOS/c1-3-10-24-18(4-2)21-15-20-19-13-8-9-14-23(19)27(17-11-6-5-7-12-17)26(28)22(20)16-25(21)29-24/h3-16H,2H2,1H3/b10-3- |
| InChIKey | JRDAOPAHVHXJHP-KMKOMSMNSA-N |
| XLogP | 7.03 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|