C23H27NO2 — CID 154980185
5-[2-[4-ethyl-3-(2-methylhexan-2-yl)phenyl]ethynyl]pyridine-2-carboxylic acid (PubChem CID 154980185) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 5-[2-[4-ethyl-3-(2-methylhexan-2-yl)phenyl]ethynyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-[4-ethyl-3-(2-methylhexan-2-yl)phenyl]ethynyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 154980185 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 5-[2-[4-ethyl-3-(2-methylhexan-2-yl)phenyl]ethynyl]pyridine-2-carboxylic acid |
| SMILES | CCCCC(C)(C)c1cc(C#Cc2ccc(C(=O)O)nc2)ccc1CC |
| InChI | InChI=1S/C23H27NO2/c1-5-7-14-23(3,4)20-15-17(10-12-19(20)6-2)8-9-18-11-13-21(22(25)26)24-16-18/h10-13,15-16H,5-7,14H2,1-4H3,(H,25,26) |
| InChIKey | HEMOMPKHWQPQSS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|