C16H24O5 — CID 15498415
trans-diethyl (2R,3R)-2-methyl-4-methylidene-3-propanoylcyclopentane-1,1-dicarboxylate (PubChem CID 15498415) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is trans-diethyl (2R,3R)-2-methyl-4-methylidene-3-propanoylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2R,3R)-2-methyl-4-methylidene-3-propanoylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15498415 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | trans-diethyl (2R,3R)-2-methyl-4-methylidene-3-propanoylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)[C@H](C)[C@H]1C(=O)CC |
| InChI | InChI=1S/C16H24O5/c1-6-12(17)13-10(4)9-16(11(13)5,14(18)20-7-2)15(19)21-8-3/h11,13H,4,6-9H2,1-3,5H3/t11-,13+/m1/s1 |
| InChIKey | BNIFPQKGCBFYQQ-YPMHNXCESA-N |
| XLogP | 2.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|