C24H19N5O2 — CID 154985072
5-methyl-3-[[3-[[(5R,6S)-3-phenyl-1-tricyclo[3.1.0.02,6]hex-2-enyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[2,3-d]pyrimidin-4-one (PubChem CID 154985072) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 5-methyl-3-[[3-[[(5R,6S)-3-phenyl-1-tricyclo[3.1.0.02,6]hex-2-enyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-methyl-3-[[3-[[(5R,6S)-3-phenyl-1-tricyclo[3.1.0.02,6]hex-2-enyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 154985072 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 5-methyl-3-[[3-[[(5R,6S)-3-phenyl-1-tricyclo[3.1.0.02,6]hex-2-enyl]methyl]-1,2,4-oxadiazol-5-yl]methyl]pyrido[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccnc2ncn(Cc3nc(CC45C6=C(c7ccccc7)C[C@@H]4[C@H]65)no3)c(=O)c12 |
| InChI | InChI=1S/C24H19N5O2/c1-13-7-8-25-22-19(13)23(30)29(12-26-22)11-18-27-17(28-31-18)10-24-16-9-15(20(24)21(16)24)14-5-3-2-4-6-14/h2-8,12,16,21H,9-11H2,1H3/t16-,21-,24?/m1/s1 |
| InChIKey | MNHCMQPFOOJCQJ-GHBAKLGXSA-N |
| XLogP | 3.18 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |