C28H33N5OS — CID 154986412
3-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-N-[2-[1-[(C-ethyl-N-methylcarbonimidoyl)-methylamino]ethenylsulfanyl]ethyl]-4-pyrazol-1-ylbenzamide (PubChem CID 154986412) has the molecular formula C28H33N5OS and a molecular weight of 487.67 g/mol. Its IUPAC name is 3-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-N-[2-[1-[(C-ethyl-N-methylcarbonimidoyl)-methylamino]ethenylsulfanyl]ethyl]-4-pyrazol-1-ylbenzamide.
| Compound Name | 3-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-N-[2-[1-[(C-ethyl-N-methylcarbonimidoyl)-methylamino]ethenylsulfanyl]ethyl]-4-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 154986412 |
| Molecular Formula | C28H33N5OS |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 3-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-N-[2-[1-[(C-ethyl-N-methylcarbonimidoyl)-methylamino]ethenylsulfanyl]ethyl]-4-pyrazol-1-ylbenzamide |
| SMILES | C=C/C(C#Cc1cc(C(=O)NCCSC(=C)N(C)/C(CC)=N/C)ccc1-n1cccn1)=C\C=C/C |
| InChI | InChI=1S/C28H33N5OS/c1-7-10-12-23(8-2)13-14-24-21-25(15-16-26(24)33-19-11-17-31-33)28(34)30-18-20-35-22(4)32(6)27(9-3)29-5/h7-8,10-12,15-17,19,21H,2,4,9,18,20H2,1,3,5-6H3,(H,30,34)/b10-7-,23-12+,29-27+ |
| InChIKey | RHJRAHBAMBZEAQ-IBGPTCFNSA-N |
| XLogP | 5.22 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|